What is the 1,2,3,4-Tetrabromobutane?

1,2,3,4-Tetrabromobutane is , while it's Molecular Formula is C4H6Br4. Used in Flame Retardant Industry: 1,2,3,4-Tetrabromobutane is used as a flame retardant for its ability to slow down or prevent the spread of fire, making it a valuable component in various applications requiring fire safety measures. Used in Chemical Synthesis: 1,2,3,4-Tetrabromobutane serves as a precursor in the production of other brominated compounds, contributing to the creation of a range of chemical products that leverage the unique properties of bromine.

What is the CAS number for 1,2,3,4-Tetrabromobutane?

The CAS number of 1,2,3,4-Tetrabromobutane is 1529-68-6.

What is 1,2,3,4-Tetrabromobutane (1529-68-6) used for?

1,2,3,4-Tetrabromobutane, with the molecular formula C4H6Br4, is a colorless liquid chemical compound characterized by a sweet, fruity odor. It is predominantly utilized as a flame retardant and in the synthesis of other brominated compounds. However, it is recognized as a hazardous substance due to its potential to cause irritation and harm when ingested, inhaled, or absorbed through the skin, necessitating strict regulation and control in many countries to mitigate its environmental and health risks.InChI:InChI=1/C4H6Br4/c5-1-3(7)4(8)2-6/h3-4H,1-2H2/t3-,4+

What is the 1,2,3,4-Tetrabromobutane?

1,2,3,4-Tetrabromobutane is , while it's Molecular Formula is C4H6Br4. Used in Flame Retardant Industry: 1,2,3,4-Tetrabromobutane is used as a flame retardant for its ability to slow down or prevent the spread of fire, making it a valuable component in various applications requiring fire safety measures. Used in Chemical Synthesis: 1,2,3,4-Tetrabromobutane serves as a precursor in the production of other brominated compounds, contributing to the creation of a range of chemical products that leverage the unique properties of bromine.

What is the CAS number for 1,2,3,4-Tetrabromobutane?

The CAS number of 1,2,3,4-Tetrabromobutane is 1529-68-6.

What is 1,2,3,4-Tetrabromobutane (1529-68-6) used for?

1,2,3,4-Tetrabromobutane, with the molecular formula C4H6Br4, is a colorless liquid chemical compound characterized by a sweet, fruity odor. It is predominantly utilized as a flame retardant and in the synthesis of other brominated compounds. However, it is recognized as a hazardous substance due to its potential to cause irritation and harm when ingested, inhaled, or absorbed through the skin, necessitating strict regulation and control in many countries to mitigate its environmental and health risks.InChI:InChI=1/C4H6Br4/c5-1-3(7)4(8)2-6/h3-4H,1-2H2/t3-,4+

Products

Current location：Home > Products > 1,2,3,4-Tetrabromobutane

1,2,3,4-Tetrabromobutane

Name 1,2,3,4-Tetrabromobutane
CAS 1529-68-6
Purity 99%

Inquiry

Product Details

Manufacturer Supply Best Quality 1,2,3,4-Tetrabromobutane 1529-68-6 with Efficient Transportation

Molecular Formula: C4H6Br4
Molecular Weight: 373.708
Vapor Pressure: 0.00115mmHg at 25°C
Melting Point: 40-41oC
Refractive Index: 1.611
Boiling Point: 309.609 °C at 760 mmHg
Flash Point: 138.338 °C
PSA： 0.00000
Density: 2.524 g/cm³
LogP: 3.30320

1,2,3,4-Tetrabromobutane(Cas 1529-68-6) Usage

General Description

1,2,3,4-Tetrabromobutane is a chemical compound with the molecular formula C4H6Br4. It is a colorless liquid with a sweet, fruity odor and is primarily used as a flame retardant and in the production of other brominated compounds. It is also known to be a hazardous substance when ingested, inhaled, or absorbed through the skin, and exposure to high concentrations can cause irritation of the skin, eyes, and respiratory system. Due to its potential environmental and health hazards, 1,2,3,4-Tetrabromobutane is regulated and is not commonly used in consumer products. Furthermore, its production and use are strictly controlled and regulated in many countries.

InChI:InChI=1/C4H6Br4/c5-1-3(7)4(8)2-6/h3-4H,1-2H2/t3-,4+